C19H18ClNO3S2 — CID 31838372
3-chloro-4,5-dimethoxy-N,N-bis(thiophen-2-ylmethyl)benzamide (PubChem CID 31838372) has the molecular formula C19H18ClNO3S2 and a molecular weight of 407.94 g/mol. Its IUPAC name is 3-chloro-4,5-dimethoxy-N,N-bis(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-chloro-4,5-dimethoxy-N,N-bis(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 31838372 |
| Molecular Formula | C19H18ClNO3S2 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 3-chloro-4,5-dimethoxy-N,N-bis(thiophen-2-ylmethyl)benzamide |
| SMILES | COc1cc(C(=O)N(Cc2cccs2)Cc2cccs2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H18ClNO3S2/c1-23-17-10-13(9-16(20)18(17)24-2)19(22)21(11-14-5-3-7-25-14)12-15-6-4-8-26-15/h3-10H,11-12H2,1-2H3 |
| InChIKey | DJDHMXKESMKOKK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |