C16H18BrNO3S — CID 17473350
3-bromo-5-ethoxy-4-methoxy-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 17473350) has the molecular formula C16H18BrNO3S and a molecular weight of 384.30 g/mol. Its IUPAC name is 3-bromo-5-ethoxy-4-methoxy-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | 3-bromo-5-ethoxy-4-methoxy-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 17473350 |
| Molecular Formula | C16H18BrNO3S |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 3-bromo-5-ethoxy-4-methoxy-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | CCOc1cc(C(=O)NCCc2cccs2)cc(Br)c1OC |
| InChI | InChI=1S/C16H18BrNO3S/c1-3-21-14-10-11(9-13(17)15(14)20-2)16(19)18-7-6-12-5-4-8-22-12/h4-5,8-10H,3,6-7H2,1-2H3,(H,18,19) |
| InChIKey | QNEWWADARLPYDR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |