C15H19BrNO2S+ — CID 7315118
(3-bromo-5-ethoxy-4-methoxyphenyl)methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 7315118) has the molecular formula C15H19BrNO2S+ and a molecular weight of 357.29 g/mol. Its IUPAC name is (3-bromo-5-ethoxy-4-methoxyphenyl)methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | (3-bromo-5-ethoxy-4-methoxyphenyl)methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7315118 |
| Molecular Formula | C15H19BrNO2S+ |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | (3-bromo-5-ethoxy-4-methoxyphenyl)methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | CCOc1cc(C[NH2+]Cc2cccs2)cc(Br)c1OC |
| InChI | InChI=1S/C15H18BrNO2S/c1-3-19-14-8-11(7-13(16)15(14)18-2)9-17-10-12-5-4-6-20-12/h4-8,17H,3,9-10H2,1-2H3/p+1 |
| InChIKey | VGSFOISURXGMJA-UHFFFAOYSA-O |
| XLogP | 3.18 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |