C14H16BrNO2S — CID 63776382
[3-bromo-5-methoxy-4-(2-thiophen-2-ylethoxy)phenyl]methanamine (PubChem CID 63776382) has the molecular formula C14H16BrNO2S and a molecular weight of 342.26 g/mol. Its IUPAC name is [3-bromo-5-methoxy-4-(2-thiophen-2-ylethoxy)phenyl]methanamine.
| Compound Name | [3-bromo-5-methoxy-4-(2-thiophen-2-ylethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 63776382 |
| Molecular Formula | C14H16BrNO2S |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | [3-bromo-5-methoxy-4-(2-thiophen-2-ylethoxy)phenyl]methanamine |
| SMILES | COc1cc(CN)cc(Br)c1OCCc1cccs1 |
| InChI | InChI=1S/C14H16BrNO2S/c1-17-13-8-10(9-16)7-12(15)14(13)18-5-4-11-3-2-6-19-11/h2-3,6-8H,4-5,9,16H2,1H3 |
| InChIKey | AUFVHTWKGCHYJK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |