C14H14Cl2O2S — CID 63776256
2-[2-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]ethyl]thiophene (PubChem CID 63776256) has the molecular formula C14H14Cl2O2S and a molecular weight of 317.24 g/mol. Its IUPAC name is 2-[2-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]ethyl]thiophene.
| Compound Name | 2-[2-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]ethyl]thiophene |
|---|---|
| PubChem CID | 63776256 |
| Molecular Formula | C14H14Cl2O2S |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-[2-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]ethyl]thiophene |
| SMILES | COc1cc(CCl)cc(Cl)c1OCCc1cccs1 |
| InChI | InChI=1S/C14H14Cl2O2S/c1-17-13-8-10(9-15)7-12(16)14(13)18-5-4-11-3-2-6-19-11/h2-3,6-8H,4-5,9H2,1H3 |
| InChIKey | GHFWZJSXWIRUIX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|