C16H18ClNO3 — CID 60891318
4-[2-[4-(chloromethyl)-2,6-dimethoxyphenoxy]ethyl]pyridine (PubChem CID 60891318) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 4-[2-[4-(chloromethyl)-2,6-dimethoxyphenoxy]ethyl]pyridine.
| Compound Name | 4-[2-[4-(chloromethyl)-2,6-dimethoxyphenoxy]ethyl]pyridine |
|---|---|
| PubChem CID | 60891318 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-[2-[4-(chloromethyl)-2,6-dimethoxyphenoxy]ethyl]pyridine |
| SMILES | COc1cc(CCl)cc(OC)c1OCCc1ccncc1 |
| InChI | InChI=1S/C16H18ClNO3/c1-19-14-9-13(11-17)10-15(20-2)16(14)21-8-5-12-3-6-18-7-4-12/h3-4,6-7,9-10H,5,8,11H2,1-2H3 |
| InChIKey | JFDJDGUPVKCDGW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|