C16H17BrClNO2 — CID 60891684
4-[2-[2-bromo-4-(chloromethyl)-6-ethoxyphenoxy]ethyl]pyridine (PubChem CID 60891684) has the molecular formula C16H17BrClNO2 and a molecular weight of 370.67 g/mol. Its IUPAC name is 4-[2-[2-bromo-4-(chloromethyl)-6-ethoxyphenoxy]ethyl]pyridine.
| Compound Name | 4-[2-[2-bromo-4-(chloromethyl)-6-ethoxyphenoxy]ethyl]pyridine |
|---|---|
| PubChem CID | 60891684 |
| Molecular Formula | C16H17BrClNO2 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 4-[2-[2-bromo-4-(chloromethyl)-6-ethoxyphenoxy]ethyl]pyridine |
| SMILES | CCOc1cc(CCl)cc(Br)c1OCCc1ccncc1 |
| InChI | InChI=1S/C16H17BrClNO2/c1-2-20-15-10-13(11-18)9-14(17)16(15)21-8-5-12-3-6-19-7-4-12/h3-4,6-7,9-10H,2,5,8,11H2,1H3 |
| InChIKey | OTQBXGQBWLHVCE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|