C13H19ClO3S — CID 113473809
5-(chloromethyl)-2-(2-ethylsulfanylethoxy)-1,3-dimethoxybenzene (PubChem CID 113473809) has the molecular formula C13H19ClO3S and a molecular weight of 290.81 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(2-ethylsulfanylethoxy)-1,3-dimethoxybenzene.
| Compound Name | 5-(chloromethyl)-2-(2-ethylsulfanylethoxy)-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 113473809 |
| Molecular Formula | C13H19ClO3S |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-(chloromethyl)-2-(2-ethylsulfanylethoxy)-1,3-dimethoxybenzene |
| SMILES | CCSCCOc1c(OC)cc(CCl)cc1OC |
| InChI | InChI=1S/C13H19ClO3S/c1-4-18-6-5-17-13-11(15-2)7-10(9-14)8-12(13)16-3/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | IUCCATAOWFKMMB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|