C16H20ClNO3S — CID 7248523
(2S)-1-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]propan-2-ol (PubChem CID 7248523) has the molecular formula C16H20ClNO3S and a molecular weight of 341.86 g/mol. Its IUPAC name is (2S)-1-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]propan-2-ol.
| Compound Name | (2S)-1-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 7248523 |
| Molecular Formula | C16H20ClNO3S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (2S)-1-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]propan-2-ol |
| SMILES | COc1cc(CNC[C@H](C)O)cc(Cl)c1OCc1cccs1 |
| InChI | InChI=1S/C16H20ClNO3S/c1-11(19)8-18-9-12-6-14(17)16(15(7-12)20-2)21-10-13-4-3-5-22-13/h3-7,11,18-19H,8-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | PXQOUHZNTBKIFP-NSHDSACASA-N |
| XLogP | 3.46 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |