C21H22ClNO3S — CID 8637889
(1S)-2-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]-1-phenylethanol (PubChem CID 8637889) has the molecular formula C21H22ClNO3S and a molecular weight of 403.93 g/mol. Its IUPAC name is (1S)-2-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]-1-phenylethanol.
| Compound Name | (1S)-2-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 8637889 |
| Molecular Formula | C21H22ClNO3S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (1S)-2-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]-1-phenylethanol |
| SMILES | COc1cc(CNC[C@@H](O)c2ccccc2)cc(Cl)c1OCc1cccs1 |
| InChI | InChI=1S/C21H22ClNO3S/c1-25-20-11-15(12-23-13-19(24)16-6-3-2-4-7-16)10-18(22)21(20)26-14-17-8-5-9-27-17/h2-11,19,23-24H,12-14H2,1H3/t19-/m1/s1 |
| InChIKey | VVKLBOPOWVGVDO-LJQANCHMSA-N |
| XLogP | 4.81 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |