C15H18ClNO2S — CID 4715962
N-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine (PubChem CID 4715962) has the molecular formula C15H18ClNO2S and a molecular weight of 311.83 g/mol. Its IUPAC name is N-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 4715962 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Cl)c(OCc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C15H18ClNO2S/c1-3-17-9-11-7-13(16)15(14(8-11)18-2)19-10-12-5-4-6-20-12/h4-8,17H,3,9-10H2,1-2H3 |
| InChIKey | ANOHALAMVQWJMM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |