C23H28ClNO2S — CID 4721798
N-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]adamantan-1-amine (PubChem CID 4721798) has the molecular formula C23H28ClNO2S and a molecular weight of 418.00 g/mol. Its IUPAC name is N-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]adamantan-1-amine.
| Compound Name | N-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]adamantan-1-amine |
|---|---|
| PubChem CID | 4721798 |
| Molecular Formula | C23H28ClNO2S |
| Molecular Weight | 418.00 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]adamantan-1-amine |
| SMILES | COc1cc(CNC23CC4CC(CC(C4)C2)C3)cc(Cl)c1OCc1cccs1 |
| InChI | InChI=1S/C23H28ClNO2S/c1-26-21-9-18(8-20(24)22(21)27-14-19-3-2-4-28-19)13-25-23-10-15-5-16(11-23)7-17(6-15)12-23/h2-4,8-9,15-17,25H,5-7,10-14H2,1H3 |
| InChIKey | HHNIBWWFXHCXPJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.00 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |