C12H10Cl2O2S — CID 18504596
3,5-dichloro-4-(2-thiophen-2-ylethoxy)phenol (PubChem CID 18504596) has the molecular formula C12H10Cl2O2S and a molecular weight of 289.18 g/mol. Its IUPAC name is 3,5-dichloro-4-(2-thiophen-2-ylethoxy)phenol.
| Compound Name | 3,5-dichloro-4-(2-thiophen-2-ylethoxy)phenol |
|---|---|
| PubChem CID | 18504596 |
| Molecular Formula | C12H10Cl2O2S |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 3,5-dichloro-4-(2-thiophen-2-ylethoxy)phenol |
| SMILES | Oc1cc(Cl)c(OCCc2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2O2S/c13-10-6-8(15)7-11(14)12(10)16-4-3-9-2-1-5-17-9/h1-2,5-7,15H,3-4H2 |
| InChIKey | CFLFEDLHQXPWDG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |