C13H13Cl2NOS — CID 54930333
2-[3,5-dichloro-2-(thiophen-2-ylmethoxy)phenyl]ethanamine (PubChem CID 54930333) has the molecular formula C13H13Cl2NOS and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-[3,5-dichloro-2-(thiophen-2-ylmethoxy)phenyl]ethanamine.
| Compound Name | 2-[3,5-dichloro-2-(thiophen-2-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 54930333 |
| Molecular Formula | C13H13Cl2NOS |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2-[3,5-dichloro-2-(thiophen-2-ylmethoxy)phenyl]ethanamine |
| SMILES | NCCc1cc(Cl)cc(Cl)c1OCc1cccs1 |
| InChI | InChI=1S/C13H13Cl2NOS/c14-10-6-9(3-4-16)13(12(15)7-10)17-8-11-2-1-5-18-11/h1-2,5-7H,3-4,8,16H2 |
| InChIKey | DILVSECHTLZKLN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |