C10H11Cl2F2NO — CID 60922555
2-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]ethanamine (PubChem CID 60922555) has the molecular formula C10H11Cl2F2NO and a molecular weight of 270.11 g/mol. Its IUPAC name is 2-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]ethanamine.
| Compound Name | 2-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 60922555 |
| Molecular Formula | C10H11Cl2F2NO |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 2-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]ethanamine |
| SMILES | NCCc1cc(Cl)cc(Cl)c1OCC(F)F |
| InChI | InChI=1S/C10H11Cl2F2NO/c11-7-3-6(1-2-15)10(8(12)4-7)16-5-9(13)14/h3-4,9H,1-2,5,15H2 |
| InChIKey | BOOFZKMZMNFOMH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |