C13H11BrF2OS — CID 79887659
2-[2-[4-(bromomethyl)-2,6-difluorophenoxy]ethyl]thiophene (PubChem CID 79887659) has the molecular formula C13H11BrF2OS and a molecular weight of 333.20 g/mol. Its IUPAC name is 2-[2-[4-(bromomethyl)-2,6-difluorophenoxy]ethyl]thiophene.
| Compound Name | 2-[2-[4-(bromomethyl)-2,6-difluorophenoxy]ethyl]thiophene |
|---|---|
| PubChem CID | 79887659 |
| Molecular Formula | C13H11BrF2OS |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 2-[2-[4-(bromomethyl)-2,6-difluorophenoxy]ethyl]thiophene |
| SMILES | Fc1cc(CBr)cc(F)c1OCCc1cccs1 |
| InChI | InChI=1S/C13H11BrF2OS/c14-8-9-6-11(15)13(12(16)7-9)17-4-3-10-2-1-5-18-10/h1-2,5-7H,3-4,8H2 |
| InChIKey | SCPFVJRIDXDZOT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|