C13H15N3O2S2 — CID 103607000
N-[(6-methoxy-3-pyridinyl)methyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 103607000) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is N-[(6-methoxy-3-pyridinyl)methyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[(6-methoxy-3-pyridinyl)methyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 103607000 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-[(6-methoxy-3-pyridinyl)methyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | COc1ccc(CNC(=O)Cc2sc(=S)[nH]c2C)cn1 |
| InChI | InChI=1S/C13H15N3O2S2/c1-8-10(20-13(19)16-8)5-11(17)14-6-9-3-4-12(18-2)15-7-9/h3-4,7H,5-6H2,1-2H3,(H,14,17)(H,16,19) |
| InChIKey | RWJCVHMENANCGX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|