C21H25N3OS — CID 110317818
N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]adamantane-1-carboxamide (PubChem CID 110317818) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 110317818 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]adamantane-1-carboxamide |
| SMILES | O=C(NCCc1nc(-c2ccncc2)cs1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H25N3OS/c25-20(21-10-14-7-15(11-21)9-16(8-14)12-21)23-6-3-19-24-18(13-26-19)17-1-4-22-5-2-17/h1-2,4-5,13-16H,3,6-12H2,(H,23,25) |
| InChIKey | ABFJZXZLZVVUKG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |