C16H23N3OS — CID 62799816
N-(1-adamantylmethyl)-2-(2-amino-1,3-thiazol-4-yl)acetamide (PubChem CID 62799816) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-(2-amino-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-(2-amino-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 62799816 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-(1-adamantylmethyl)-2-(2-amino-1,3-thiazol-4-yl)acetamide |
| SMILES | Nc1nc(CC(=O)NCC23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C16H23N3OS/c17-15-19-13(8-21-15)4-14(20)18-9-16-5-10-1-11(6-16)3-12(2-10)7-16/h8,10-12H,1-7,9H2,(H2,17,19)(H,18,20) |
| InChIKey | NAOMSZBOBFPWLG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |