C11H21NO3 — CID 107299926
N-(4-hydroxypentyl)-2-methyloxolane-2-carboxamide (PubChem CID 107299926) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is N-(4-hydroxypentyl)-2-methyloxolane-2-carboxamide.
| Compound Name | N-(4-hydroxypentyl)-2-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 107299926 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | N-(4-hydroxypentyl)-2-methyloxolane-2-carboxamide |
| SMILES | CC(O)CCCNC(=O)C1(C)CCCO1 |
| InChI | InChI=1S/C11H21NO3/c1-9(13)5-3-7-12-10(14)11(2)6-4-8-15-11/h9,13H,3-8H2,1-2H3,(H,12,14) |
| InChIKey | SYIVOTSESIRBFQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|