C16H29N3O3 — CID 125437379
1-[3-[[(2R)-2-methyloxane-2-carbonyl]amino]propyl]piperidine-4-carboxamide (PubChem CID 125437379) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-[3-[[(2R)-2-methyloxane-2-carbonyl]amino]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[(2R)-2-methyloxane-2-carbonyl]amino]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 125437379 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 1-[3-[[(2R)-2-methyloxane-2-carbonyl]amino]propyl]piperidine-4-carboxamide |
| SMILES | C[C@]1(C(=O)NCCCN2CCC(C(N)=O)CC2)CCCCO1 |
| InChI | InChI=1S/C16H29N3O3/c1-16(7-2-3-12-22-16)15(21)18-8-4-9-19-10-5-13(6-11-19)14(17)20/h13H,2-12H2,1H3,(H2,17,20)(H,18,21)/t16-/m1/s1 |
| InChIKey | KOPWWKRDQOZAEZ-MRXNPFEDSA-N |
| XLogP | 0.65 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|