C19H30N2O2 — CID 154817706
(1S,3R,4R)-4-amino-N-(3-phenylpropyl)-3-propoxycyclohexane-1-carboxamide (PubChem CID 154817706) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,3R,4R)-4-amino-N-(3-phenylpropyl)-3-propoxycyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R)-4-amino-N-(3-phenylpropyl)-3-propoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 154817706 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | (1S,3R,4R)-4-amino-N-(3-phenylpropyl)-3-propoxycyclohexane-1-carboxamide |
| SMILES | CCCO[C@@H]1C[C@@H](C(=O)NCCCc2ccccc2)CC[C@H]1N |
| InChI | InChI=1S/C19H30N2O2/c1-2-13-23-18-14-16(10-11-17(18)20)19(22)21-12-6-9-15-7-4-3-5-8-15/h3-5,7-8,16-18H,2,6,9-14,20H2,1H3,(H,21,22)/t16-,17+,18+/m0/s1 |
| InChIKey | DLPKAOMGBKJYKD-RCCFBDPRSA-N |
| XLogP | 2.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|