C18H26Cl2N2O4 — CID 155939771
(1S,3R,4R)-4-amino-N-[(3,4-dichlorophenyl)methyl]-3-propoxycyclohexane-1-carboxamide;formic acid (PubChem CID 155939771) has the molecular formula C18H26Cl2N2O4 and a molecular weight of 405.32 g/mol. Its IUPAC name is (1S,3R,4R)-4-amino-N-[(3,4-dichlorophenyl)methyl]-3-propoxycyclohexane-1-carboxamide;formic acid.
| Compound Name | (1S,3R,4R)-4-amino-N-[(3,4-dichlorophenyl)methyl]-3-propoxycyclohexane-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 155939771 |
| Molecular Formula | C18H26Cl2N2O4 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (1S,3R,4R)-4-amino-N-[(3,4-dichlorophenyl)methyl]-3-propoxycyclohexane-1-carboxamide;formic acid |
| SMILES | CCCO[C@@H]1C[C@@H](C(=O)NCc2ccc(Cl)c(Cl)c2)CC[C@H]1N.O=CO |
| InChI | InChI=1S/C17H24Cl2N2O2.CH2O2/c1-2-7-23-16-9-12(4-6-15(16)20)17(22)21-10-11-3-5-13(18)14(19)8-11;2-1-3/h3,5,8,12,15-16H,2,4,6-7,9-10,20H2,1H3,(H,21,22);1H,(H,2,3)/t12-,15+,16+;/m0./s1 |
| InChIKey | RMLOUOGHPKVZLA-VEVZXVCZSA-N |
| XLogP | 3.23 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|