C18H24N2OS — CID 95119560
(2S)-2-(dimethylamino)-2-(3-methylphenyl)-N-[2-(3-methylthiophen-2-yl)ethyl]acetamide (PubChem CID 95119560) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is (2S)-2-(dimethylamino)-2-(3-methylphenyl)-N-[2-(3-methylthiophen-2-yl)ethyl]acetamide.
| Compound Name | (2S)-2-(dimethylamino)-2-(3-methylphenyl)-N-[2-(3-methylthiophen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 95119560 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (2S)-2-(dimethylamino)-2-(3-methylphenyl)-N-[2-(3-methylthiophen-2-yl)ethyl]acetamide |
| SMILES | Cc1cccc([C@@H](C(=O)NCCc2sccc2C)N(C)C)c1 |
| InChI | InChI=1S/C18H24N2OS/c1-13-6-5-7-15(12-13)17(20(3)4)18(21)19-10-8-16-14(2)9-11-22-16/h5-7,9,11-12,17H,8,10H2,1-4H3,(H,19,21)/t17-/m0/s1 |
| InChIKey | LYASTRDEHXDMAK-KRWDZBQOSA-N |
| XLogP | 3.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |