C17H27N3O2 — CID 72849089
N-[2-[[2-(dimethylamino)-2-(3-methylphenyl)acetyl]amino]ethyl]-2-methylpropanamide (PubChem CID 72849089) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[2-[[2-(dimethylamino)-2-(3-methylphenyl)acetyl]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[2-(dimethylamino)-2-(3-methylphenyl)acetyl]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 72849089 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N-[2-[[2-(dimethylamino)-2-(3-methylphenyl)acetyl]amino]ethyl]-2-methylpropanamide |
| SMILES | Cc1cccc(C(C(=O)NCCNC(=O)C(C)C)N(C)C)c1 |
| InChI | InChI=1S/C17H27N3O2/c1-12(2)16(21)18-9-10-19-17(22)15(20(4)5)14-8-6-7-13(3)11-14/h6-8,11-12,15H,9-10H2,1-5H3,(H,18,21)(H,19,22) |
| InChIKey | UVFFONKFTZAQOF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|