C14H11N3OS — CID 116575719
2-(2-amino-1,3-thiazol-4-yl)-1-quinolin-6-ylethanone (PubChem CID 116575719) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-1-quinolin-6-ylethanone.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-1-quinolin-6-ylethanone |
|---|---|
| PubChem CID | 116575719 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-1-quinolin-6-ylethanone |
| SMILES | Nc1nc(CC(=O)c2ccc3ncccc3c2)cs1 |
| InChI | InChI=1S/C14H11N3OS/c15-14-17-11(8-19-14)7-13(18)10-3-4-12-9(6-10)2-1-5-16-12/h1-6,8H,7H2,(H2,15,17) |
| InChIKey | CGQNUSGDEDAXRW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |