C28H33F6N3O3 — CID 88876232
1-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-(oxan-3-yl)urea (PubChem CID 88876232) has the molecular formula C28H33F6N3O3 and a molecular weight of 573.58 g/mol. Its IUPAC name is 1-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-(oxan-3-yl)urea.
| Compound Name | 1-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-(oxan-3-yl)urea |
|---|---|
| PubChem CID | 88876232 |
| Molecular Formula | C28H33F6N3O3 |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | 1-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-(oxan-3-yl)urea |
| SMILES | O=C(Nc1ccc(CC2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1)NC1CCCOC1 |
| InChI | InChI=1S/C28H33F6N3O3/c29-27(30,31)26(39,28(32,33)34)22-7-3-21(4-8-22)17-37-13-11-20(12-14-37)16-19-5-9-23(10-6-19)35-25(38)36-24-2-1-15-40-18-24/h3-10,20,24,39H,1-2,11-18H2,(H2,35,36,38) |
| InChIKey | RHJFDXBLQOHVJB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |