C28H31ClF6N4O4 — CID 44511980
1-[2-chloro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(4-hydroxycyclohexyl)urea (PubChem CID 44511980) has the molecular formula C28H31ClF6N4O4 and a molecular weight of 637.02 g/mol. Its IUPAC name is 1-[2-chloro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-[2-chloro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 44511980 |
| Molecular Formula | C28H31ClF6N4O4 |
| Molecular Weight | 637.02 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | 1-[2-chloro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(4-hydroxycyclohexyl)urea |
| SMILES | O=C(Nc1ccc(C(=O)N2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1Cl)NC1CCC(O)CC1 |
| InChI | InChI=1S/C28H31ClF6N4O4/c29-22-15-18(3-10-23(22)37-25(42)36-20-6-8-21(40)9-7-20)24(41)39-13-11-38(12-14-39)16-17-1-4-19(5-2-17)26(43,27(30,31)32)28(33,34)35/h1-5,10,15,20-21,40,43H,6-9,11-14,16H2,(H2,36,37,42) |
| InChIKey | OBZWUNLCLVZIKA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.02 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |