C27H24F7N5O3 — CID 44512329
1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-pyridin-2-ylurea (PubChem CID 44512329) has the molecular formula C27H24F7N5O3 and a molecular weight of 599.51 g/mol. Its IUPAC name is 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-pyridin-2-ylurea.
| Compound Name | 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 44512329 |
| Molecular Formula | C27H24F7N5O3 |
| Molecular Weight | 599.51 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-pyridin-2-ylurea |
| SMILES | O=C(Nc1ccccn1)Nc1ccc(C(=O)N2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1F |
| InChI | InChI=1S/C27H24F7N5O3/c28-20-15-18(6-9-21(20)36-24(41)37-22-3-1-2-10-35-22)23(40)39-13-11-38(12-14-39)16-17-4-7-19(8-5-17)25(42,26(29,30)31)27(32,33)34/h1-10,15,42H,11-14,16H2,(H2,35,36,37,41) |
| InChIKey | MWNMEHXNAWOQER-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |