C32H43F7N4O4Si — CID 72535256
1-[4-[4-[[4-[2-[tert-butyl(dimethyl)silyl]oxy-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]methyl]piperazine-1-carbonyl]-2-fluorophenyl]-3-(1-hydroxybutan-2-yl)urea (PubChem CID 72535256) has the molecular formula C32H43F7N4O4Si and a molecular weight of 708.79 g/mol. Its IUPAC name is 1-[4-[4-[[4-[2-[tert-butyl(dimethyl)silyl]oxy-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]methyl]piperazine-1-carbonyl]-2-fluorophenyl]-3-(1-hydroxybutan-2-yl)urea.
| Compound Name | 1-[4-[4-[[4-[2-[tert-butyl(dimethyl)silyl]oxy-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]methyl]piperazine-1-carbonyl]-2-fluorophenyl]-3-(1-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 72535256 |
| Molecular Formula | C32H43F7N4O4Si |
| Molecular Weight | 708.79 g/mol |
| Exact Mass | 708.29 |
| IUPAC Name | 1-[4-[4-[[4-[2-[tert-butyl(dimethyl)silyl]oxy-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]methyl]piperazine-1-carbonyl]-2-fluorophenyl]-3-(1-hydroxybutan-2-yl)urea |
| SMILES | CCC(CO)NC(=O)Nc1ccc(C(=O)N2CCN(Cc3ccc(C(O[Si](C)(C)C(C)(C)C)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1F |
| InChI | InChI=1S/C32H43F7N4O4Si/c1-7-24(20-44)40-28(46)41-26-13-10-22(18-25(26)33)27(45)43-16-14-42(15-17-43)19-21-8-11-23(12-9-21)30(31(34,35)36,32(37,38)39)47-48(5,6)29(2,3)4/h8-13,18,24,44H,7,14-17,19-20H2,1-6H3,(H2,40,41,46) |
| InChIKey | LFIQNVULGORSLV-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.79 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|