C27H29F7N4O3S — CID 87253463
1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(thian-4-yl)urea (PubChem CID 87253463) has the molecular formula C27H29F7N4O3S and a molecular weight of 622.61 g/mol. Its IUPAC name is 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(thian-4-yl)urea.
| Compound Name | 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(thian-4-yl)urea |
|---|---|
| PubChem CID | 87253463 |
| Molecular Formula | C27H29F7N4O3S |
| Molecular Weight | 622.61 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(thian-4-yl)urea |
| SMILES | O=C(Nc1ccc(C(=O)N2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1F)NC1CCSCC1 |
| InChI | InChI=1S/C27H29F7N4O3S/c28-21-15-18(3-6-22(21)36-24(40)35-20-7-13-42-14-8-20)23(39)38-11-9-37(10-12-38)16-17-1-4-19(5-2-17)25(41,26(29,30)31)27(32,33)34/h1-6,15,20,41H,7-14,16H2,(H2,35,36,40) |
| InChIKey | SBMSLOXKOYQXCE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |