C26H29F8N3O3 — CID 118311332
1-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-(3-fluoro-2-hydroxypropyl)urea (PubChem CID 118311332) has the molecular formula C26H29F8N3O3 and a molecular weight of 583.52 g/mol. Its IUPAC name is 1-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-(3-fluoro-2-hydroxypropyl)urea.
| Compound Name | 1-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-(3-fluoro-2-hydroxypropyl)urea |
|---|---|
| PubChem CID | 118311332 |
| Molecular Formula | C26H29F8N3O3 |
| Molecular Weight | 583.52 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | 1-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-(3-fluoro-2-hydroxypropyl)urea |
| SMILES | O=C(NCC(O)CF)Nc1ccc(CC2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1F |
| InChI | InChI=1S/C26H29F8N3O3/c27-13-20(38)14-35-23(39)36-22-6-3-18(12-21(22)28)11-16-7-9-37(10-8-16)15-17-1-4-19(5-2-17)24(40,25(29,30)31)26(32,33)34/h1-6,12,16,20,38,40H,7-11,13-15H2,(H2,35,36,39) |
| InChIKey | SBZOUSXRWXFHIG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |