C27H26F7N5O2 — CID 52919310
1-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-pyrimidin-4-ylurea (PubChem CID 52919310) has the molecular formula C27H26F7N5O2 and a molecular weight of 585.52 g/mol. Its IUPAC name is 1-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-pyrimidin-4-ylurea.
| Compound Name | 1-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-pyrimidin-4-ylurea |
|---|---|
| PubChem CID | 52919310 |
| Molecular Formula | C27H26F7N5O2 |
| Molecular Weight | 585.52 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | 1-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]-3-pyrimidin-4-ylurea |
| SMILES | O=C(Nc1ccncn1)Nc1ccc(CC2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1F |
| InChI | InChI=1S/C27H26F7N5O2/c28-21-14-19(3-6-22(21)37-24(40)38-23-7-10-35-16-36-23)13-17-8-11-39(12-9-17)15-18-1-4-20(5-2-18)25(41,26(29,30)31)27(32,33)34/h1-7,10,14,16-17,41H,8-9,11-13,15H2,(H2,35,36,37,38,40) |
| InChIKey | NOYBNPWFFGQHJI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |