C27H29F7N4O3 — CID 123588380
1-(1-amino-3-oxobutylidene)-3-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]urea (PubChem CID 123588380) has the molecular formula C27H29F7N4O3 and a molecular weight of 590.54 g/mol. Its IUPAC name is 1-(1-amino-3-oxobutylidene)-3-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]urea.
| Compound Name | 1-(1-amino-3-oxobutylidene)-3-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 123588380 |
| Molecular Formula | C27H29F7N4O3 |
| Molecular Weight | 590.54 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 1-(1-amino-3-oxobutylidene)-3-[2-fluoro-4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]urea |
| SMILES | CC(=O)CC(N)=NC(=O)Nc1ccc(CC2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1F |
| InChI | InChI=1S/C27H29F7N4O3/c1-16(39)12-23(35)37-24(40)36-22-7-4-19(14-21(22)28)13-17-8-10-38(11-9-17)15-18-2-5-20(6-3-18)25(41,26(29,30)31)27(32,33)34/h2-7,14,17,41H,8-13,15H2,1H3,(H3,35,36,37,40) |
| InChIKey | UROGERITOUBUKZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|