C15H19F3N2O3 — CID 94797817
1-[(2S)-3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 94797817) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 1-[(2S)-3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(2S)-3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 94797817 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[(2S)-3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NC[C@H](O)COCC1CC1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O3/c16-15(17,18)11-3-5-12(6-4-11)20-14(22)19-7-13(21)9-23-8-10-1-2-10/h3-6,10,13,21H,1-2,7-9H2,(H2,19,20,22)/t13-/m0/s1 |
| InChIKey | VIAHANIHYHWAMU-ZDUSSCGKSA-N |
| XLogP | 2.61 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |