C13H16F3N3O — CID 63767514
1-(2-amino-2-cyclopropylethyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 63767514) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is 1-(2-amino-2-cyclopropylethyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-amino-2-cyclopropylethyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 63767514 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-(2-amino-2-cyclopropylethyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | NC(CNC(=O)Nc1ccc(C(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C13H16F3N3O/c14-13(15,16)9-3-5-10(6-4-9)19-12(20)18-7-11(17)8-1-2-8/h3-6,8,11H,1-2,7,17H2,(H2,18,19,20) |
| InChIKey | GNOKEJIJWRFOPY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |