C14H19FN2O3 — CID 94801888
1-[(2S)-3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-(4-fluorophenyl)urea (PubChem CID 94801888) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is 1-[(2S)-3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(2S)-3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 94801888 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-[(2S)-3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(NC[C@H](O)COCC1CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O3/c15-11-3-5-12(6-4-11)17-14(19)16-7-13(18)9-20-8-10-1-2-10/h3-6,10,13,18H,1-2,7-9H2,(H2,16,17,19)/t13-/m0/s1 |
| InChIKey | QKAMDUOUSORXRB-ZDUSSCGKSA-N |
| XLogP | 1.73 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |