C12H14F2O4S2 — CID 105116549
3-(3-ethylsulfanylpropylsulfonyl)-4,5-difluorobenzoic acid (PubChem CID 105116549) has the molecular formula C12H14F2O4S2 and a molecular weight of 324.37 g/mol. Its IUPAC name is 3-(3-ethylsulfanylpropylsulfonyl)-4,5-difluorobenzoic acid.
| Compound Name | 3-(3-ethylsulfanylpropylsulfonyl)-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 105116549 |
| Molecular Formula | C12H14F2O4S2 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 3-(3-ethylsulfanylpropylsulfonyl)-4,5-difluorobenzoic acid |
| SMILES | CCSCCCS(=O)(=O)c1cc(C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C12H14F2O4S2/c1-2-19-4-3-5-20(17,18)10-7-8(12(15)16)6-9(13)11(10)14/h6-7H,2-5H2,1H3,(H,15,16) |
| InChIKey | TYNWEJQXBWMJEQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|