C13H17F2NO4S — CID 105116158
3-[2-(diethylamino)ethylsulfonyl]-4,5-difluorobenzoic acid (PubChem CID 105116158) has the molecular formula C13H17F2NO4S and a molecular weight of 321.35 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethylsulfonyl]-4,5-difluorobenzoic acid.
| Compound Name | 3-[2-(diethylamino)ethylsulfonyl]-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 105116158 |
| Molecular Formula | C13H17F2NO4S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-[2-(diethylamino)ethylsulfonyl]-4,5-difluorobenzoic acid |
| SMILES | CCN(CC)CCS(=O)(=O)c1cc(C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C13H17F2NO4S/c1-3-16(4-2)5-6-21(19,20)11-8-9(13(17)18)7-10(14)12(11)15/h7-8H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | YYLPYCVETJGMMX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |