C11H10F2N2O4S — CID 105111550
3-[2-cyanoethyl(methyl)sulfamoyl]-4,5-difluorobenzoic acid (PubChem CID 105111550) has the molecular formula C11H10F2N2O4S and a molecular weight of 304.27 g/mol. Its IUPAC name is 3-[2-cyanoethyl(methyl)sulfamoyl]-4,5-difluorobenzoic acid.
| Compound Name | 3-[2-cyanoethyl(methyl)sulfamoyl]-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 105111550 |
| Molecular Formula | C11H10F2N2O4S |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3-[2-cyanoethyl(methyl)sulfamoyl]-4,5-difluorobenzoic acid |
| SMILES | CN(CCC#N)S(=O)(=O)c1cc(C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C11H10F2N2O4S/c1-15(4-2-3-14)20(18,19)9-6-7(11(16)17)5-8(12)10(9)13/h5-6H,2,4H2,1H3,(H,16,17) |
| InChIKey | AGKIQINWTQAFCB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |