C12H15BrO5S — CID 55052958
4-bromo-3-(5-hydroxypentylsulfonyl)benzoic acid (PubChem CID 55052958) has the molecular formula C12H15BrO5S and a molecular weight of 351.22 g/mol. Its IUPAC name is 4-bromo-3-(5-hydroxypentylsulfonyl)benzoic acid.
| Compound Name | 4-bromo-3-(5-hydroxypentylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 55052958 |
| Molecular Formula | C12H15BrO5S |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 4-bromo-3-(5-hydroxypentylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1ccc(Br)c(S(=O)(=O)CCCCCO)c1 |
| InChI | InChI=1S/C12H15BrO5S/c13-10-5-4-9(12(15)16)8-11(10)19(17,18)7-3-1-2-6-14/h4-5,8,14H,1-3,6-7H2,(H,15,16) |
| InChIKey | CGKQLTXAGPSIMI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|