C13H17BrO6S — CID 103180851
4-bromo-3-[2-(3-methoxypropoxy)ethylsulfonyl]benzoic acid (PubChem CID 103180851) has the molecular formula C13H17BrO6S and a molecular weight of 381.24 g/mol. Its IUPAC name is 4-bromo-3-[2-(3-methoxypropoxy)ethylsulfonyl]benzoic acid.
| Compound Name | 4-bromo-3-[2-(3-methoxypropoxy)ethylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 103180851 |
| Molecular Formula | C13H17BrO6S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 4-bromo-3-[2-(3-methoxypropoxy)ethylsulfonyl]benzoic acid |
| SMILES | COCCCOCCS(=O)(=O)c1cc(C(=O)O)ccc1Br |
| InChI | InChI=1S/C13H17BrO6S/c1-19-5-2-6-20-7-8-21(17,18)12-9-10(13(15)16)3-4-11(12)14/h3-4,9H,2,5-8H2,1H3,(H,15,16) |
| InChIKey | YZPIXSZHTWCKTG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|