C13H19BrN2O4S — CID 81479863
3-bromo-5-[2-(dimethylamino)ethyl-methylsulfamoyl]-4-methylbenzoic acid (PubChem CID 81479863) has the molecular formula C13H19BrN2O4S and a molecular weight of 379.28 g/mol. Its IUPAC name is 3-bromo-5-[2-(dimethylamino)ethyl-methylsulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-bromo-5-[2-(dimethylamino)ethyl-methylsulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 81479863 |
| Molecular Formula | C13H19BrN2O4S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 3-bromo-5-[2-(dimethylamino)ethyl-methylsulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1c(Br)cc(C(=O)O)cc1S(=O)(=O)N(C)CCN(C)C |
| InChI | InChI=1S/C13H19BrN2O4S/c1-9-11(14)7-10(13(17)18)8-12(9)21(19,20)16(4)6-5-15(2)3/h7-8H,5-6H2,1-4H3,(H,17,18) |
| InChIKey | YCHRRTYBVLFJGN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |