C16H16F3NO3S — CID 78870952
2,4-difluoro-N-[3-(4-fluorophenoxy)propyl]-N-methylbenzenesulfonamide (PubChem CID 78870952) has the molecular formula C16H16F3NO3S and a molecular weight of 359.37 g/mol. Its IUPAC name is 2,4-difluoro-N-[3-(4-fluorophenoxy)propyl]-N-methylbenzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[3-(4-fluorophenoxy)propyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 78870952 |
| Molecular Formula | C16H16F3NO3S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2,4-difluoro-N-[3-(4-fluorophenoxy)propyl]-N-methylbenzenesulfonamide |
| SMILES | CN(CCCOc1ccc(F)cc1)S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H16F3NO3S/c1-20(9-2-10-23-14-6-3-12(17)4-7-14)24(21,22)16-8-5-13(18)11-15(16)19/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | YKFOWGMAIFJQBZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|