C14H16FNO3S2 — CID 39967068
N-[3-(4-fluorophenoxy)propyl]-N-methylthiophene-2-sulfonamide (PubChem CID 39967068) has the molecular formula C14H16FNO3S2 and a molecular weight of 329.42 g/mol. Its IUPAC name is N-[3-(4-fluorophenoxy)propyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | N-[3-(4-fluorophenoxy)propyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 39967068 |
| Molecular Formula | C14H16FNO3S2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-[3-(4-fluorophenoxy)propyl]-N-methylthiophene-2-sulfonamide |
| SMILES | CN(CCCOc1ccc(F)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H16FNO3S2/c1-16(21(17,18)14-4-2-11-20-14)9-3-10-19-13-7-5-12(15)6-8-13/h2,4-8,11H,3,9-10H2,1H3 |
| InChIKey | XIFARPZZJKIALA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|