C12H15BrF3NO2S — CID 107206320
N-(5-bromopentyl)-2,4,6-trifluoro-N-methylbenzenesulfonamide (PubChem CID 107206320) has the molecular formula C12H15BrF3NO2S and a molecular weight of 374.22 g/mol. Its IUPAC name is N-(5-bromopentyl)-2,4,6-trifluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(5-bromopentyl)-2,4,6-trifluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107206320 |
| Molecular Formula | C12H15BrF3NO2S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | N-(5-bromopentyl)-2,4,6-trifluoro-N-methylbenzenesulfonamide |
| SMILES | CN(CCCCCBr)S(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H15BrF3NO2S/c1-17(6-4-2-3-5-13)20(18,19)12-10(15)7-9(14)8-11(12)16/h7-8H,2-6H2,1H3 |
| InChIKey | SPBCQRJLBCMMBB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|