C24H28F3N3O3S — CID 71612418
N-[[4-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl]-N-cyclobutyl-1-(2,4-difluorophenyl)methanesulfonamide (PubChem CID 71612418) has the molecular formula C24H28F3N3O3S and a molecular weight of 495.57 g/mol. Its IUPAC name is N-[[4-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl]-N-cyclobutyl-1-(2,4-difluorophenyl)methanesulfonamide.
| Compound Name | N-[[4-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl]-N-cyclobutyl-1-(2,4-difluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 71612418 |
| Molecular Formula | C24H28F3N3O3S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[[4-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl]-N-cyclobutyl-1-(2,4-difluorophenyl)methanesulfonamide |
| SMILES | CC(=O)N1CCN(c2ccc(CN(C3CCC3)S(=O)(=O)Cc3ccc(F)cc3F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H28F3N3O3S/c1-17(31)28-9-11-29(12-10-28)22-8-6-18(24(27)14-22)15-30(21-3-2-4-21)34(32,33)16-19-5-7-20(25)13-23(19)26/h5-8,13-14,21H,2-4,9-12,15-16H2,1H3 |
| InChIKey | JWMAUVXODHNCFK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|