C23H32FN5O3S — CID 144883341
1-[4-[4-[[(3S)-3,6-dimethyl-1,1-dioxothiazinan-2-yl]methyl]-3-fluorophenyl]piperazin-1-yl]ethanone;pyrimidine (PubChem CID 144883341) has the molecular formula C23H32FN5O3S and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-[4-[4-[[(3S)-3,6-dimethyl-1,1-dioxothiazinan-2-yl]methyl]-3-fluorophenyl]piperazin-1-yl]ethanone;pyrimidine.
| Compound Name | 1-[4-[4-[[(3S)-3,6-dimethyl-1,1-dioxothiazinan-2-yl]methyl]-3-fluorophenyl]piperazin-1-yl]ethanone;pyrimidine |
|---|---|
| PubChem CID | 144883341 |
| Molecular Formula | C23H32FN5O3S |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 1-[4-[4-[[(3S)-3,6-dimethyl-1,1-dioxothiazinan-2-yl]methyl]-3-fluorophenyl]piperazin-1-yl]ethanone;pyrimidine |
| SMILES | CC(=O)N1CCN(c2ccc(CN3[C@@H](C)CCC(C)S3(=O)=O)c(F)c2)CC1.c1cncnc1 |
| InChI | InChI=1S/C19H28FN3O3S.C4H4N2/c1-14-4-5-15(2)27(25,26)23(14)13-17-6-7-18(12-19(17)20)22-10-8-21(9-11-22)16(3)24;1-2-5-4-6-3-1/h6-7,12,14-15H,4-5,8-11,13H2,1-3H3;1-4H/t14-,15?;/m0./s1 |
| InChIKey | SWLMLIYWPNLXDD-QDVCFFRGSA-N |
| XLogP | 2.67 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|