C29H40FN3O3S — CID 123640538
1-[4-[3-fluoro-4-[[3-methyl-6-[4-(4-methylphenyl)butyl]-1,1-dioxothiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone (PubChem CID 123640538) has the molecular formula C29H40FN3O3S and a molecular weight of 529.72 g/mol. Its IUPAC name is 1-[4-[3-fluoro-4-[[3-methyl-6-[4-(4-methylphenyl)butyl]-1,1-dioxothiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-fluoro-4-[[3-methyl-6-[4-(4-methylphenyl)butyl]-1,1-dioxothiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 123640538 |
| Molecular Formula | C29H40FN3O3S |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 1-[4-[3-fluoro-4-[[3-methyl-6-[4-(4-methylphenyl)butyl]-1,1-dioxothiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(CN3C(C)CCC(CCCCc4ccc(C)cc4)S3(=O)=O)c(F)c2)CC1 |
| InChI | InChI=1S/C29H40FN3O3S/c1-22-8-11-25(12-9-22)6-4-5-7-28-15-10-23(2)33(37(28,35)36)21-26-13-14-27(20-29(26)30)32-18-16-31(17-19-32)24(3)34/h8-9,11-14,20,23,28H,4-7,10,15-19,21H2,1-3H3 |
| InChIKey | KAQVGZJBCKUWKY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|