C35H49N3O3S — CID 123616712
5,5-dimethyl-3-[4-[3-methyl-4-[[3-methyl-1,1-dioxo-6-(4-phenylbutyl)thiazinan-2-yl]methyl]phenyl]piperazin-1-yl]cyclohex-2-en-1-one (PubChem CID 123616712) has the molecular formula C35H49N3O3S and a molecular weight of 591.86 g/mol. Its IUPAC name is 5,5-dimethyl-3-[4-[3-methyl-4-[[3-methyl-1,1-dioxo-6-(4-phenylbutyl)thiazinan-2-yl]methyl]phenyl]piperazin-1-yl]cyclohex-2-en-1-one.
| Compound Name | 5,5-dimethyl-3-[4-[3-methyl-4-[[3-methyl-1,1-dioxo-6-(4-phenylbutyl)thiazinan-2-yl]methyl]phenyl]piperazin-1-yl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 123616712 |
| Molecular Formula | C35H49N3O3S |
| Molecular Weight | 591.86 g/mol |
| Exact Mass | 591.35 |
| IUPAC Name | 5,5-dimethyl-3-[4-[3-methyl-4-[[3-methyl-1,1-dioxo-6-(4-phenylbutyl)thiazinan-2-yl]methyl]phenyl]piperazin-1-yl]cyclohex-2-en-1-one |
| SMILES | Cc1cc(N2CCN(C3=CC(=O)CC(C)(C)C3)CC2)ccc1CN1C(C)CCC(CCCCc2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C35H49N3O3S/c1-27-22-31(36-18-20-37(21-19-36)32-23-33(39)25-35(3,4)24-32)16-15-30(27)26-38-28(2)14-17-34(42(38,40)41)13-9-8-12-29-10-6-5-7-11-29/h5-7,10-11,15-16,22-23,28,34H,8-9,12-14,17-21,24-26H2,1-4H3 |
| InChIKey | DYLRRFURDHWDEW-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.86 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|